A6154312
D-Biotin N-Succinimidyl Ester , 98% , 35013-72-0
Synonym(s):
Biotin-NHS;NHS-Biotin;Biotin-OSu;BNHS;N-(Biotinyloxy)succinimide
CAS NO.:35013-72-0
Empirical Formula: C14H19N3O5S
Molecular Weight: 341.38
MDL number: MFCD00078531
EINECS: 609-055-0
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB23.20 | In Stock |
|
| 50MG | RMB59.20 | In Stock |
|
| 250MG | RMB95.20 | In Stock |
|
| 500mg | RMB159.20 | In Stock |
|
| 1G | RMB234.40 | In Stock |
|
| 5g | RMB799.20 | In Stock |
|
| 25g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212-214 °C |
| Density | 1.45±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMF: ≤50 mg/mL Stable for at least one month in dry DMF |
| form | powder |
| pka | 13.89±0.40(Predicted) |
| color | White to off-white |
| BRN | 4720781 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C14H19N3O5S/c18-10-5-6-11(19)17(10)22-12(20)4-2-1-3-9-13-8(7-23-9)15-14(21)16-13/h8-9,13H,1-7H2,(H2,15,16,21)/t8-,9-,13-/m0/s1 |
| InChIKey | YMXHPSHLTSZXKH-RVBZMBCESA-N |
| SMILES | C1(=O)N[C@]2([H])[C@H](CCCCC(ON3C(=O)CCC3=O)=O)SC[C@]2([H])N1 |
| CAS DataBase Reference | 35013-72-0(CAS DataBase Reference) |
Description and Uses
N-
Biotin-NHS is used in the biotinylation of proteins and peptides. Couples with primary amine in the pH range 6.5-8.5.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | EUH210 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 2934 99 90 |
| Storage Class | 11 - Combustible Solids |





![4-Nitrophenyl5-((3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl)pentanoate](https://img.chemicalbook.com/CAS/GIF/33755-53-2.gif)
