A6157012
Nalidixic acid , 98% , 389-08-2
Synonym(s):
1,4-Dihydro-1-ethyl-7-methyl-1,8-naphthyridin-4-one-3-carboxylic acid;1-Ethyl-1,4-dihydro-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid
CAS NO.:389-08-2
Empirical Formula: C12H12N2O3
Molecular Weight: 232.24
MDL number: MFCD00006884
EINECS: 206-864-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB232.80 | In Stock |
|
| 100G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 227-229 °C (lit.) |
| Boiling point: | 374.4°C (rough estimate) |
| Density | 1.2243 (rough estimate) |
| refractive index | 1.6660 (estimate) |
| storage temp. | 2-8°C |
| solubility | chloroform: 20 mg/mL, clear |
| form | Powder |
| pka | pKa 6.11± 0.02(Approximate) |
| color | White to light yellow |
| biological source | synthetic |
| Water Solubility | 0.1 G/L (23 ºC) |
| Merck | 14,6359 |
| BRN | 750515 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | clinical testing |
| InChI | 1S/C12H12N2O3/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14/h4-6H,3H2,1-2H3,(H,16,17) |
| InChIKey | MHWLWQUZZRMNGJ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(O)=O)C(=O)c2ccc(C)nc12 |
| CAS DataBase Reference | 389-08-2(CAS DataBase Reference) |
| EPA Substance Registry System | Nalidixic acid (389-08-2) |
Description and Uses
For the treatment of urinary tract infections caused by susceptible gram-negative microorganisms, including the majority of E. Coli, Enterobacter species, Klebsiella species, and Proteus species.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351 |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 63-42/43-40-20/21/22-22 |
| Safety Statements | 22-36/37-45-24-36 |
| WGK Germany | 2 |
| RTECS | QN2885000 |
| F | 8-10-23 |
| HS Code | 29339190 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 |
| Hazardous Substances Data | 389-08-2(Hazardous Substances Data) |
| Toxicity | LD50 in mice (mg/kg): 3300 orally; 500 s.c.; 176 i.v. (Lesher, 1962) |







