A6160112
4′-Nitroacetophenone , 97% , 100-19-6
CAS NO.:100-19-6
Empirical Formula: C8H7NO3
Molecular Weight: 165.15
MDL number: MFCD00007355
EINECS: 202-827-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB24.00 | In Stock |
|
| 100G | RMB71.20 | In Stock |
|
| 500G | RMB279.20 | In Stock |
|
| 2.5kg | RMB1128.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-78 °C(lit.) |
| Boiling point: | 202 °C(lit.) |
| Density | 1.3450 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| Flash point: | 201-202°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Yellow |
| Water Solubility | Insoluble in water. |
| BRN | 607777 |
| InChI | InChI=1S/C8H7NO3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-5H,1H3 |
| InChIKey | YQYGPGKTNQNXMH-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C([N+]([O-])=O)C=C1)C |
| CAS DataBase Reference | 100-19-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetophenone, 4'-nitro-(100-19-6) |
| EPA Substance Registry System | 4-Nitroacetophenone (100-19-6) |
Description and Uses
4''-Nitroacetophenone is used as a reagent in the synthesis of 4-Nitroacetophenone thiosemicarbazone derivatives and their copper(II) complexes which have potential anti-trypanosomal activity in vitro. Also used as a reagent in the synthesis of (R)-(4-Nitrophenyl)oxirane (N504430) and (S)-(4-Nitrophenyl)oxirane (N504435).
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H301 |
| Precautionary statements | P301+P310a-P321-P405-P501a-P264-P270-P301+P312+P330-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36-22 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | AM9627000 |
| Hazard Note | Harmful |
| HS Code | 29147090 |
| Storage Class | 11 - Combustible Solids |







