A6162112
2,3-Naphthalenedicarboxaldehyde , 98% , 7149-49-7
Synonym(s):
NDA
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB95.20 | In Stock |
|
| 100MG | RMB316.80 | In Stock |
|
| 500MG | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-133 °C(lit.) |
| Boiling point: | 380.0±25.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystalline Powder |
| color | White to pale yellow |
| Appearance | Yellow solid |
| BRN | 2207267 |
| InChI | InChI=1S/C12H8O2/c13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14/h1-8H |
| InChIKey | ZIPLKLQPLOWLTM-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC(C=O)=C1C=O |
| CAS DataBase Reference | 7149-49-7(CAS DataBase Reference) |
Description and Uses
Naphthalene-2,3-dicarboxaldehyde is a fluorogenic derivatizing probe for amines.
Naphthalene-2,3-dicarboxaldehyde is a fluorogenic derivatizing agent for amines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| F | 3-10-23 |
| HS Code | 29122990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




