A6163412
4-Nitrophenyl β-D-glucopyranoside , 98% , 2492-87-7
Synonym(s):
p-Nitrophenyl β-D -glucopyranoside;p-Nitrophenyl-β-D-glucopyranoside - CAS 2492-87-7 - Calbiochem;p-Nitrophenyl-β-glucoside, 1-O- p-Nitrophenyl-D-glucose;p-Nitrophenyl-β-glucoside, 1-O-p-Nitrophenyl-D-glucose
CAS NO.:2492-87-7
Empirical Formula: C12H15NO8
Molecular Weight: 301.25
MDL number: MFCD00006593
EINECS: 219-661-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB131.20 | In Stock |
|
| 25G | RMB646.40 | In Stock |
|
| 100g | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-168 °C |
| Boiling point: | 442.39°C (rough estimate) |
| Density | 1.3709 (rough estimate) |
| refractive index | -102.5 ° (C=1, H2O) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | Methanol (Slightly, Sonicated), Water (Slightly) |
| form | Powder |
| pka | 12.55±0.70(Predicted) |
| color | White to yellow |
| Water Solubility | Soluble in water, methanol, warm ethanol, dimethyl sulfoxide and dimethylformamide. Insoluble in ether. |
| BRN | 92211 |
| Stability: | Hygroscopic |
| InChI | 1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | IFBHRQDFSNCLOZ-RMPHRYRLSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@@H]1O |
| LogP | -0.550 (est) |
| CAS DataBase Reference | 2492-87-7(CAS DataBase Reference) |
| EPA Substance Registry System | .beta.-D-Glucopyranoside, 4-nitrophenyl (2492-87-7) |
Description and Uses
p-Nitrophenyl β-D-Glucopyranoside (cas# 2492-87-7) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H371 |
| Precautionary statements | P260 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-68/20/21/22-36/37/38-68 |
| Safety Statements | 36/37-36-26-60-33-22 |
| WGK Germany | 3 |
| F | 3-10-21 |
| TSCA | TSCA listed |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |








