A6167012
1-Naphthylamine hydrochloride , AR , 552-46-5
Synonym(s):
1-Naphthylamine hydrochloride;1-Naphthylammonium chloride
CAS NO.:552-46-5
Empirical Formula: C10H10ClN
Molecular Weight: 179.65
MDL number: MFCD00036370
EINECS: 209-014-3
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 272-275°C |
| storage temp. | Store below +30°C. |
| solubility | 37.7g/l |
| form | Crystalline |
| color | White to pale red |
| Odor | Ammonia odour |
| Water Solubility | Soluble in water, alcohol, ether |
| Sensitive | Air Sensitive |
| Merck | 14,6398 |
| InChI | InChI=1S/C10H9N.ClH/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-7H,11H2;1H |
| InChIKey | FOKKJVHTXPJHEN-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC1=C(N)C=CC=2.Cl |
| CAS DataBase Reference | 552-46-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Naphthalenamine, hydrochloride (552-46-5) |
Description and Uses
Applied as a synthesis reagent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | 2811 |
| WGK Germany | WGK 2 water endangering |
| RTECS | QM3150000 |
| TSCA | Yes |
| HS Code | 2921 45 00 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Toxicity | LD50 orally in Rabbit: 680 mg/kg |





