A6169612
1,8-Naphthalic anhydride , 98% , 81-84-5
Synonym(s):
Naphtho[1,8,8a-c,d]pyran-1,3-dione
CAS NO.:81-84-5
Empirical Formula: C12H6O3
Molecular Weight: 198.17
MDL number: MFCD00006925
EINECS: 201-380-2
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 269 °C |
| Boiling point: | 295.48°C (rough estimate) |
| Density | 1.2571 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5550 (estimate) |
| Flash point: | 272 °C |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly, Heated), DMSO |
| form | Powder |
| color | Beige to light brown |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 153190 |
| InChI | 1S/C12H6O3/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11/h1-6H |
| InChIKey | GRSMWKLPSNHDHA-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cccc3cccc1c23 |
| LogP | 3.24 |
| Surface tension | 72.5mN/m at 1.3mg/L and 20℃ |
| CAS DataBase Reference | 81-84-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,8-Naphthalic anhydride(81-84-5) |
| EPA Substance Registry System | 1,8-Naphthalic anhydride (81-84-5) |
Description and Uses
Dyestuffs, organic synthesis in general.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 2 |
| RTECS | QK5350000 |
| F | 21 |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 81-84-5(Hazardous Substances Data) |





