A6170812
4-Nitrophenyl α-D-glucopyranoside , 99% , 3767-28-0
Synonym(s):
p-Nitrophenyl α-D -glucopyranoside;p-Nitrophenyl-α-D-glucopyranoside - CAS 3767-28-0 - Calbiochem
CAS NO.:3767-28-0
Empirical Formula: C12H15NO8
Molecular Weight: 301.25
MDL number: MFCD00064088
EINECS: 223-189-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB142.40 | In Stock |
|
| 5G | RMB620.80 | In Stock |
|
| 25g | RMB2600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-216 °C |
| Boiling point: | 442.39°C (rough estimate) |
| Density | 1.3709 (rough estimate) |
| refractive index | 218.5 ° (C=0.5, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | DMF: 10 mg/ml,DMSO: 10 mg/ml,Ethanol: Slightly soluble,PBS (pH 7.2): 0.3 mg/ml |
| form | Crystalline Powder |
| pka | 12.55±0.70(Predicted) |
| color | Off-white to light yellow |
| Water Solubility | Soluble in water, warm ethanol and methanol. |
| BRN | 92212 |
| InChI | InChI=1/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11-,12+/s3 |
| InChIKey | IFBHRQDFSNCLOZ-ZIQFBCGOSA-N |
| SMILES | O(C1C=CC(N(=O)=O)=CC=1)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |&1:10,12,15,17,19,r| |
| CAS DataBase Reference | 3767-28-0(CAS DataBase Reference) |
Description and Uses
Substrate for a-glucosidase inhibitor
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264b-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362+P364-P403+P233-P501c |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HS Code | 29389090 |







