A6172512
3-Nitrophenylboronic acid(contains varying amounts of Anhydride) , 97% , 13331-27-6
Synonym(s):
m-Nitrobenzeneboronic acid;m-Nitrophenylboronic acid;3-Nitrobenzeneboronic acid;NSC 401539;NSC 59739
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB68.00 | In Stock |
|
| 25G | RMB239.20 | In Stock |
|
| 100G | RMB719.20 | In Stock |
|
| 500g | RMB3439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 284-285 °C (dec.) (lit.) |
| Boiling point: | 363.3±44.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Ethanol,Methanol,Ether |
| form | Powder |
| pka | 6.93±0.10(Predicted) |
| color | Light yellow to pale brown |
| Water Solubility | soluble in hot water |
| Sensitive | Hygroscopic |
| BRN | 2938638 |
| InChI | InChI=1S/C6H6BNO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4,9-10H |
| InChIKey | ZNRGSYUVFVNSAW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC([N+]([O-])=O)=C1)(O)O |
| CAS DataBase Reference | 13331-27-6(CAS DataBase Reference) |
| EPA Substance Registry System | Boronic acid, (3-nitrophenyl)- (13331-27-6) |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | CY8980000 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
| Storage Class | 11 - Combustible Solids |





