A6173612
2-Nitrobenzoic acid , 98% , 552-16-9
CAS NO.:552-16-9
Empirical Formula: C7H5NO4
Molecular Weight: 167.12
MDL number: MFCD00007137
EINECS: 209-004-9
| Pack Size | Price | Stock | Quantity |
| 10g | RMB28.00 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB127.20 | In Stock |
|
| 500G | RMB468.80 | In Stock |
|
| 2.5KG | RMB2127.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148 °C(lit.) |
| Boiling point: | 295.67°C (rough estimate) |
| Density | 1,58 g/cm3 |
| refractive index | 1.6280 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 7.8g/l |
| pka | 2.16(at 18℃) |
| form | Fine Powder |
| Specific Gravity | 1.58 |
| color | Off-white |
| Water Solubility | 6.8 g/L |
| Merck | 14,6588 |
| BRN | 1910632 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI | 1S/C7H5NO4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10) |
| InChIKey | SLAMLWHELXOEJZ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccccc1[N+]([O-])=O |
| CAS DataBase Reference | 552-16-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2-nitro-(552-16-9) |
| EPA Substance Registry System | o-Nitrobenzoic acid (552-16-9) |
Description and Uses
NH2-protecting reagent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-68-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | DH5050000 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






