A6175412
1,2-Naphthoquinone-4-sulfonic acid sodium salt , 98% , 521-24-4
Synonym(s):
1,2-Naphthoquinone-4-sulfonic acid sodium salt;3,4-Dihydro-3,4-dioxo-1-naphthalenesulfonic acid sodium salt;Folin’s reagent;Sodium 1,2-naphthoquinone-4-sulfonate
CAS NO.：521-24-4
Empirical Formula: C10H5NaO5S
Molecular Weight: 260.2
MDL number: MFCD00001700
EINECS: 208-308-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.80 | In Stock |
|
| 5G | RMB141.60 | In Stock |
|
| 25G | RMB471.20 | In Stock |
|
| 100g | RMB1290.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL, clear |
| form | solid |
| color | dark orange |
| Odor | Odorless |
| Water Solubility | Soluble in water and acetone. Slightly soluble in alcohol and ethanol. Insoluble in chloroform. |
| Merck | 14,8646 |
| BRN | 4169788 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C10H6O5S.Na/c11-8-5-9(16(13,14)15)6-3-1-2-4-7(6)10(8)12;/h1-5H,(H,13,14,15);/q;+1/p-1 |
| InChIKey | UBLXEEBHYISRFM-UHFFFAOYSA-M |
| SMILES | C1(=CC(C(=O)C2C=CC=CC1=2)=O)S([O-])(=O)=O.[Na+] |
| CAS DataBase Reference | 521-24-4(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2-Naphthoquinone-4-sulfonic acid sodium salt (521-24-4) |
Description and Uses
1,2-Naphthoquinone-4-sulfonic acid sodium salt is used in the characterization of phanerochaete chrysosporium. Used in the synthesis of carbohydrate based napthoquinones as anticancer agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | QK1490000 |
| TSCA | Yes |
| HS Code | 29147000 |
