A6175612
Neohesperidin dihydrochalcone , ≥98.0%(T) , 20702-77-6
Synonym(s):
1-(4-((2-O-[6-Deoxy-α-L -mannopyranosyl]-β-D -glucopyranosyl)oxy)-2,6-dihydroxyphenyl)-3-[3-hydroxy-4-methoxyphenyl]-1-propanone;NHDC
CAS NO.:20702-77-6
Empirical Formula: C28H36O15
Molecular Weight: 612.58
MDL number: MFCD00017711
EINECS: 243-978-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB68.00 | In Stock |
|
| 5G | RMB359.20 | In Stock |
|
| 25G | RMB591.20 | In Stock |
|
| 100g | RMB1956.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-158 °C(lit.) |
| Boiling point: | 927.1±65.0 °C(Predicted) |
| Density | 1.61±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| FEMA | 3811 | NEOHESPERIDIN DIHYDROCHALCONE |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Practically insoluble in water, freely soluble in dimethyl sulfoxide, soluble in methanol, practically insoluble in methylene chloride. |
| pka | 6.85±0.40(Predicted) |
| form | crystalline |
| color | light yellow |
| Odor | at 100.00 %. bland odor |
| Odor Type | odorless |
| biological source | synthetic |
| Water Solubility | Insoluble |
| Merck | 14,6452 |
| Stability: | Hygroscopic |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | FLAVOURING FRAGRANCE PERFUMING |
| InChIKey | ITVGXXMINPYUHD-CUVHLRMHSA-N |
| SMILES | COc1ccc(CCC(=O)c2c(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[C@@H]4O[C@@H](C)[C@H](O)[C@@H](O)[C@H]4O)cc2O)cc1O |
| LogP | 0.67 at 20℃ |
| CAS DataBase Reference | 20702-77-6(CAS DataBase Reference) |
| EPA Substance Registry System | Neohesperidin dihydrochalcone (20702-77-6) |
Description and Uses
Neohesperidin dihydrochalcone hydrate, is a flavonoid sweetening agent with potent antioxidant activity. It is antioxidant agent. artificial sweetener, especially in chewing gum and dentifrices.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| RTECS | LZ5785000 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |




