A6177712
1-Naphthyl phosphate monosodium salt monohydrate , 98% , 81012-89-7
Synonym(s):
α-Naphthyl Acid Phosphate, Monosodium Salt - CAS 81012-89-7 - Calbiochem;α-Naphthyl phosphate monosodium salt monohydrate;Sodium 1-naphthyl phosphate monohydrate
CAS NO.:81012-89-7
Empirical Formula: C10H10NaO5P
Molecular Weight: 264.15
MDL number: MFCD00150615
EINECS: 676-830-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB158.40 | In Stock |
|
| 5G | RMB503.20 | In Stock |
|
| 25G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189-191 °C |
| storage temp. | 2-8°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | white to off-white |
| Odor | Odorless |
| Water Solubility | Soluble in water. |
| BRN | 1877764 |
| InChI | InChI=1S/C10H9O4P.Na.H2O.H/c11-15(12,13)14-10-7-3-5-8-4-1-2-6-9(8)10;;;/h1-7H,(H2,11,12,13);;1H2; |
| InChIKey | FNGKGMLTSQMUHJ-UHFFFAOYSA-N |
| SMILES | O(C1=CC=CC2=CC=CC=C12)P(O)(O)=O.[NaH].O |
| CAS DataBase Reference | 81012-89-7(CAS DataBase Reference) |
Description and Uses
1-Naphthyl phosphate monosodium salt monohydrate has been used as a non-specific phosphatase inhibitor in the splice correction assay in HeLa pLuc 705 cells.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 29199000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




