A6177912
Nonyl β-D-glucopyranoside , 98% , 69984-73-2
Synonym(s):
n-Nonyl-β-D-glucopyranoside;Detergent Screening Solution 06/Kit-No 66317;Nonyl β-D -glucopyranoside solution
CAS NO.:69984-73-2
Empirical Formula: C15H30O6
Molecular Weight: 306.4
MDL number: MFCD00063300
EINECS: 615-042-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB191.20 | In Stock |
|
| 1G | RMB471.20 | In Stock |
|
| 5G | RMB1750.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70°C(lit.) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | Powder |
| color | White to Off-white |
| Water Solubility | water: 250mg/mL |
| BRN | 12168 |
| InChI | InChI=1/C15H30O6/c1-2-3-4-5-6-7-8-9-20-15-14(19)13(18)12(17)11(10-16)21-15/h11-19H,2-10H2,1H3/t11-,12-,13+,14-,15-/s3 |
| InChIKey | QFAPUKLCALRPLH-UXXRCYHCSA-N |
| SMILES | [C@H]1(OCCCCCCCCC)[C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O |&1:0,11,13,14,16,r| |
Description and Uses
n-Nonyl-beta-D-glucopyranoside is a nonionic surfactant.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,C,F |
| Risk Statements | 36/37/38-34-11 |
| Safety Statements | 26-36-45-36/37/39-16 |
| WGK Germany | 3 |
| F | 3-9 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |





