A6179912
2-Naphthalenemethanol , 98% , 1592-38-7
CAS NO.:1592-38-7
Empirical Formula: C11H10O
Molecular Weight: 158.2
MDL number: MFCD00004124
EINECS: 812-602-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB576.00 | In Stock |
|
| 500g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-81 °C (lit.) |
| Boiling point: | 178°C/12mmHg(lit.) |
| Density | 0.9887 (rough estimate) |
| refractive index | 1.5440 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| form | Crystalline Powder |
| pka | 14.29±0.10(Predicted) |
| color | White |
| InChI | InChI=1S/C11H10O/c12-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,12H,8H2 |
| InChIKey | MFGWMAAZYZSWMY-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CO |
| CAS DataBase Reference | 1592-38-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Naphthalenemethanol(1592-38-7) |
Description and Uses
2-Naphthalenemethanol was used as marker in the determination of critical micelle concentration of anionic surfactants by capillary electrophoresis. It was used in the synthesis of acetate protected xylosides.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,C,F |
| Risk Statements | 11-34 |
| Safety Statements | 24/25-45-36/37/39-26-16 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |



