A6180512
α-Naphthoflavone , 98% , 604-59-1
Synonym(s):
7,8-Benzoflavone;alpha-Naphthoflavone
CAS NO.:604-59-1
Empirical Formula: C19H12O2
Molecular Weight: 272.3
MDL number: MFCD00004985
EINECS: 210-071-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB52.00 | In Stock |
|
| 5G | RMB209.60 | In Stock |
|
| 25G | RMB798.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-157 °C (lit.) |
| Boiling point: | 375.35°C (rough estimate) |
| Density | 1.1382 (rough estimate) |
| refractive index | 1.5510 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Crystalline Powder or Crystals |
| color | yellow |
| BRN | 210862 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H |
| InChIKey | VFMMPHCGEFXGIP-UHFFFAOYSA-N |
| SMILES | C12=C3C(C=CC=C3)=CC=C1C(=O)C=C(C1=CC=CC=C1)O2 |
| LogP | 5.003 (est) |
| CAS DataBase Reference | 604-59-1(CAS DataBase Reference) |
| EPA Substance Registry System | 4H-Naphtho[1,2-b]pyran-4-one, 2-phenyl- (604-59-1) |
Description and Uses
α-Naphthylflavone is a flavenoid compound that acts on μ-opioid receptors in the treatment of pain. Also acts as a non-steroidal aromatase inhibitor used in breast cancer therapy.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H413 |
| Precautionary statements | P264-P270-P273-P301+P312-P330 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn,C,F |
| Risk Statements | 68-34-11 |
| Safety Statements | 24/25-36/37-45-36/37/39-26-16 |
| WGK Germany | 3 |
| RTECS | QL6250000 |
| F | 8 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |





