A6183712
Nitrofen solution , analyticalstandard,100ug/mlinpetroleumether , 1836-75-5
Synonym(s):
2,4-Dichlorophenyl 4-nitrophenyl ether;TOK
CAS NO.:1836-75-5
Empirical Formula: C12H7Cl2NO3
Molecular Weight: 284.09
MDL number: MFCD00128026
EINECS: 217-406-0
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB120.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-70°C |
| Boiling point: | 368 ºC |
| Density | 1.3 |
| refractive index | 1.6140 (estimate) |
| Flash point: | 205℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Solid |
| color | White to Light yellow |
| biological source | human blood |
| Water Solubility | 1mg/L(22 ºC) |
| Merck | 14,6598 |
| BRN | 1887356 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C12H7Cl2NO3/c13-8-1-6-12(11(14)7-8)18-10-4-2-9(3-5-10)15(16)17/h1-7H |
| InChIKey | XITQUSLLOSKDTB-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| NIST Chemistry Reference | 2,4-Dichloro-4'-nitrodiphenyl ether(1836-75-5) |
| IARC | 2B (Vol. 30, Sup 7) 1987 |
| EPA Substance Registry System | Nitrofen (1836-75-5) |
Description and Uses
Formerly as herbicide.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H350-H360D-H410 |
| Precautionary statements | P201-P202-P264-P273-P301+P312-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 45-61-50/53-22 |
| Safety Statements | 45-53-61-60-50/53-22 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | KN8400000 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29093090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Repr. 1B |
| Hazardous Substances Data | 1836-75-5(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 3.58 g/kg (Ambrose) |





