A6194112
5-Nitrouracil , 99% , 611-08-5
Synonym(s):
2,4-Dihydroxy-5-nitropyrimidine
CAS NO.：611-08-5
Empirical Formula: C4H3N3O4
Molecular Weight: 157.08
MDL number: MFCD00006021
EINECS: 210-250-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB49.60 | In Stock |
|
| 100G | RMB155.20 | In Stock |
|
| 500G | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C(lit.) |
| Boiling point: | 281.7°C (rough estimate) |
| Density | 1.8278 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO, Water |
| pka | 5.19±0.10(Predicted) |
| form | Crystalline Powder or Needles |
| color | Off-white to pale yellow |
| Water Solubility | 3.61g/L(25 ºC) |
| BRN | 10410 |
| InChI | InChI=1S/C4H3N3O4/c8-3-2(7(10)11)1-5-4(9)6-3/h1H,(H2,5,6,8,9) |
| InChIKey | TUARVSWVPPVUGS-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C([N+]([O-])=O)C(=O)N1 |
| CAS DataBase Reference | 611-08-5(CAS DataBase Reference) |
| EPA Substance Registry System | 5-Nitrouracil (611-08-5) |
Description and Uses
5-Nitrouracil (cas# 611-08-5) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 22-24/25-45-36/37/39-26-16 |
| WGK Germany | 2 |
| RTECS | UV9104545 |
| TSCA | Yes |
| HS Code | 29335990 |
