A6195712
4-Nitropyridine N-oxide , 98% , 1124-33-0
CAS NO.:1124-33-0
Empirical Formula: C5H4N2O3
Molecular Weight: 140.1
MDL number: MFCD00006206
EINECS: 214-395-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB64.80 | In Stock |
|
| 100G | RMB236.80 | In Stock |
|
| 500G | RMB1035.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 159-162 °C (lit.) |
| Boiling point: | 256.56°C (rough estimate) |
| Density | 1.5657 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in DMSO |
| pka | -1.37±0.10(Predicted) |
| form | Crystals or Powder |
| color | Yellow to brown |
| Water Solubility | insoluble |
| BRN | 124331 |
| InChI | InChI=1S/C5H4N2O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4H |
| InChIKey | RXKNNAKAVAHBNK-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C([N+]([O-])=O)C=1 |
| CAS DataBase Reference | 1124-33-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridine-1-oxide, 4-nitro-(1124-33-0) |
| EPA Substance Registry System | 4-Nitropyridine-1-oxide (1124-33-0) |
Description and Uses
4-Nitropyridine N-oxide may be used in the preparation of several 4-substituted pyridine-N-oxides and pyridines.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335-H300-H341 |
| Precautionary statements | P261-P301+P310-P305+P351+P338-P201-P301+P310a-P405-P501a |
| Hazard Codes | T |
| Risk Statements | 25-36/37/38-40-23/24/25 |
| Safety Statements | 26-45-37/39-28A-36-22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UT6380000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333999 |
| Hazardous Substances Data | 1124-33-0(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 107 mg/kg JWMAA9 29,830,65 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







