A6196712
2-Nitro-4-(trifluoromethoxy)aniline , 98% , 2267-23-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB183.20 | In Stock |
|
| 100g | RMB559.20 | In Stock |
|
| 500g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62 °C |
| Boiling point: | 284.3±35.0 °C(Predicted) |
| Density | 1.543±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | powder to crystal |
| pka | -1.38±0.10(Predicted) |
| color | Light yellow to Brown |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C7H5F3N2O3/c8-7(9,10)15-4-1-2-5(11)6(3-4)12(13)14/h1-3H,11H2 |
| InChIKey | YCGFVAPIBALHRT-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC(F)(F)F)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 2267-23-4(CAS DataBase Reference) |
Description and Uses
2-Nitro-4-(trifluoromethoxy)aniline can be used as arthropodicides.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H302-H312-H331-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | T,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 23-36/37/39-26 |
| RIDADR | UN2811 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| HS Code | 2921420090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
