A6198412
Nonaethylene Glycol , ≥94.0%(GC) , 3386-18-3
CAS NO.:3386-18-3
Empirical Formula: C18H38O10
Molecular Weight: 414.49
MDL number: MFCD00698692
EINECS: 222-206-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB52.00 | In Stock |
|
| 1G | RMB148.00 | In Stock |
|
| 5g | RMB556.00 | In Stock |
|
| 25g | RMB1594.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 24.0-25.2 °C |
| Boiling point: | 190 °C(Press: 0.01 Torr) |
| Density | 1.115±0.06 g/cm3(Predicted) |
| refractive index | 1.46 |
| Flash point: | 26 °C |
| storage temp. | 2-8°C |
| form | powder to lump |
| pka | 14.06±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C18H38O10/c19-1-3-21-5-7-23-9-11-25-13-15-27-17-18-28-16-14-26-12-10-24-8-6-22-4-2-20/h19-20H,1-18H2 |
| InChIKey | YZUUTMGDONTGTN-UHFFFAOYSA-N |
| SMILES | C(O)COCCOCCOCCOCCOCCOCCOCCOCCO |
| EPA Substance Registry System | Nonaethylene glycol (3386-18-3) |
Description and Uses
Nonaethylene glycol is a polymer consisting of ethylene glycol repeating units and terminal hydroxyl groups. The ethylene glycol units have high water solubility properties. The hydroxyl groups can react in order to further derivatize the compound.
HO-PEG9-OH is used as a reactant in the selective inhibition of human brain tumor cells through quantum-dot-based siRNA delivery.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| RTECS | RA5400000 |
| HS Code | 2905.39.9000 |



