A6199512
4-(2-Naphthyl)benzeneboronic acid , 97% , 918655-03-5
CAS NO.：918655-03-5
Empirical Formula: C16H13BO2
Molecular Weight: 248.08
MDL number: MFCD09260454
EINECS: 805-884-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB34.40 | In Stock |
|
| 1G | RMB107.20 | In Stock |
|
| 5G | RMB437.60 | In Stock |
|
| 25g | RMB1969.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 463.0±48.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 8.58±0.16(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C16H13BO2/c18-17(19)16-9-7-13(8-10-16)15-6-5-12-3-1-2-4-14(12)11-15/h1-11,18-19H |
| InChIKey | ICQAKBYFBIWELX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=CC=C3C(=C2)C=CC=C3)C=C1)(O)O |
| CAS DataBase Reference | 918655-03-5 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 29319000 |
