PRODUCT Properties
| Boiling point: | 92-94 °C12 mm Hg(lit.) |
| Density | 1.473 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 203 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | 5.53±0.14(Predicted) |
| color | Yellow to orange |
| BRN | 2215510 |
| InChI | 1S/C7H4F3NO3/c8-7(9,10)4-1-2-6(12)5(3-4)11(13)14/h1-3,12H |
| InChIKey | XZEDEVRSUANQEM-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1[N+]([O-])=O)C(F)(F)F |
| CAS DataBase Reference | 400-99-7(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 2-nitro-4-(trifluoromethyl)- (400-99-7) |
Description and Uses
2-Nitro-4-(trifluoromethyl)phenol has been used in the synthesis of 2-methyl-2-[2-nitro-4-(trifluoromethyl)phenoxy]propionic acid ethyl ester.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| RTECS | GP2984950 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29089990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 ipr-mus: 800 mg/kg JPMSAE 57,1763,68 |
