PRODUCT Properties
| Boiling point: | 240-242 °C(lit.) |
| Density | 1.391 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C7H4F3NO3/c8-7(9,10)14-6-3-1-2-5(4-6)11(12)13/h1-4H |
| InChIKey | QBWJNDOQIAARBT-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=CC(OC(F)(F)F)=C1 |
| CAS DataBase Reference | 2995-45-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2909309090 |
