A6202312
4-Nitro-2-(trifluoromethyl)aniline , ≥98.0% , 121-01-7
Synonym(s):
2-Amino-5-nitrobenzotrifluoride;4-Nitro-α,α,α-trifluoro-o-toluidine
CAS NO.:121-01-7
Empirical Formula: C7H5F3N2O2
Molecular Weight: 206.12
MDL number: MFCD00007365
EINECS: 204-443-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB18.40 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB75.20 | In Stock |
|
| 100G | RMB230.40 | In Stock |
|
| 500g | RMB869.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C(lit.) |
| Boiling point: | 298.0±35.0 °C(Predicted) |
| Density | 1.4711 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -1.92±0.36(Predicted) |
| form | Powder |
| color | Yellow to brown |
| BRN | 2121347 |
| InChI | InChI=1S/C7H5F3N2O2/c8-7(9,10)5-3-4(12(13)14)1-2-6(5)11/h1-3H,11H2 |
| InChIKey | HOTZLWVITTVZGY-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C([N+]([O-])=O)C=C1C(F)(F)F |
| CAS DataBase Reference | 121-01-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Amino-5-nitrobenzotrifluoride(121-01-7) |
Description and Uses
4-Nitro-2-(trifluoromethyl)aniline undergoes diazotization and coupling with:
N-hydroxyalkylamino-5-napthols
pyrazolones and naptholsulphonic acids
N-(2-cyanoethyl)-N-(hydroxyalkyl)anilines
4-Nitro-2-(trifluoromethyl)aniline was used in the synthesis of monoazo dyes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37-24/25-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |




