A6211112
Naproxen Sodium , ≥98% , 26159-34-2
Synonym(s):
(S)-6-Methoxy-α-methyl-2-naphthaleneacetic acid sodium salt
CAS NO.：26159-34-2
Empirical Formula: C14H13O3.Na
Molecular Weight: 252.24
MDL number: MFCD00058507
EINECS: 247-486-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB89.60 | In Stock |
|
| 25G | RMB428.80 | In Stock |
|
| 100G | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 250-251°C |
| alpha | D -11° (in methanol) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Freely soluble in water, freely soluble or soluble in methanol, sparingly soluble in ethanol (96 per cent). |
| form | Solid |
| color | White to Off-White |
| biological source | synthetic (organic) |
| Water Solubility | Soluble in water up to 100mg/mlSoluble in methanol and chloroform. Slightly soluble in ether. Insoluble in water. |
| InChI | InChI=1/C14H14O3.Na/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10;/h3-9H,1-2H3,(H,15,16);/q;+1/p-1/t9-;/s3 |
| InChIKey | CDBRNDSHEYLDJV-OVMXBOEKNA-M |
| SMILES | C12C=CC(OC)=CC1=CC=C([C@H](C)C([O-])=O)C=2.[Na+] |&1:11,r| |
| CAS DataBase Reference | 26159-34-2(CAS DataBase Reference) |
Description and Uses
An anti-inflammatory, analgesic, antipyretic. A non-steroidal anti-inflammatory
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H360 |
| Precautionary statements | P201-P202-P264-P270-P301+P312-P308+P313 |
| Hazard Codes | Xn,T |
| Risk Statements | 22-61 |
| Safety Statements | 53-45 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | QJ1047000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2918992090 |
