Norethindrone , ≥98% , 68-22-4
Synonym(s):
Norethindrone;19-Norethindrone;ELK;EPB1;Eph receptor B1
CAS NO.:68-22-4
Empirical Formula: C20H26O2
Molecular Weight: 298.43
MDL number: MFCD00067596
EINECS: 200-681-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB143.20 | In Stock |
|
| 25g | RMB639.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 205-206 °C (lit.) |
| alpha | D20 -31.7° (chloroform); D20 -25° (chloroform) |
| Boiling point: | 379.83°C (rough estimate) |
| Density | 1.0766 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | 2-8°C |
| solubility | chloroform: ≥50 mg/mL, clear, colorless |
| form | powder |
| pka | 13.09±0.40(Predicted) |
| color | white to off-white |
| biological source | rabbit |
| Water Solubility | 7.043mg/L(25 ºC) |
| Merck | 6697 |
| BRN | 1915671 |
| Specific Activity | 122-165nmol/min·mg |
| BCS Class | 1 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C20H26O2/c1-3-20(22)11-9-18-17-6-4-13-12-14(21)5-7-15(13)16(17)8-10-19(18,20)2/h1,12,15-18,22H,4-11H2,2H3/t15-,16+,17+,18-,19-,20-/m0/s1 |
| InChIKey | VIKNJXKGJWUCNN-XGXHKTLJSA-N |
| SMILES | O[C@@]1([C@@]2([C@H]([C@H]3[C@@H]([C@H]4CCC(=O)C=C4CC3)CC2)CC1)C)C#C |
| CAS DataBase Reference | 68-22-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Norethindrone(68-22-4) |
| EPA Substance Registry System | Norethisterone (68-22-4) |
Description and Uses
Norethindrone is a progestin (a synthetic substance with properties similar to progesterone) that is best known as the first female oral contraceptive, or the “pill.”Norethindrone’s global impact on society and culture has made it one of the most important inventions in history.
Progestin contraceptives work by producing pregnant-like conditions in a female to preventovulation.During pregnancy, progesterone is released by the placenta during development ofthe fetus.This in turn suppresses development of egg follicles and ovulation. Progestins mimicthis condition and thus prevent or delay ovulation.Oral contraceptives currently use progestinand estrogen in combination to prevent ovulation and thicken cervical mucus.The latter makeit harder for sperm to enter the uterus and for an egg to implant on the uterine wall.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H351-H360FD-H362-H410 |
| Precautionary statements | P202-P260-P263-P264-P273-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 40-36/37/38-20/21/22 |
| Safety Statements | 22-36/37/39-45-37/39-26 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | RC8975000 |
| HS Code | 29144000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Lact. Repr. 1A |
| Hazardous Substances Data | 68-22-4(Hazardous Substances Data) |
| Toxicity | LD50 oral in mouse: 6gm/kg |







