Nocodazole , ≥98% , 31430-18-9
Synonym(s):
[5-(2-Thienylcarbonyl)-1H-benzimidazol-2-yl]-carbamic acid methyl ester;Methyl [5-(2-thienylcarbonyl)-1H-benzimidazol-2-yl]carbamate;Methyl N-(5-thenoyl-2-benzimidazolyl)carbamate;Oncodazole
CAS NO.:31430-18-9
Empirical Formula: C14H11N3O3S
Molecular Weight: 301.32
MDL number: MFCD00005588
EINECS: 250-626-5
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB239.20 | In Stock |
|
| 50MG | RMB639.20 | In Stock |
|
| 250mg | RMB1919.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 300 °C (dec.) |
| Density | 1.490 |
| refractive index | 1.6740 (estimate) |
| storage temp. | -20°C |
| solubility | DMSO: 10 mg/mL, soluble |
| pka | 10.67±0.10(Predicted) |
| form | powder |
| color | white |
| biological source | synthetic |
| BRN | 1085978 |
| Stability: | Stable for 2 years as supplied. Solutions in DMSO may be stored at -20° for up to 2 months. |
| InChI | InChI=1S/C14H11N3O3S/c1-20-14(19)17-13-15-9-5-4-8(7-10(9)16-13)12(18)11-3-2-6-21-11/h2-7H,1H3,(H2,15,16,17,19) |
| InChIKey | KYRVNWMVYQXFEU-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)NC1NC2=CC(C(C3SC=CC=3)=O)=CC=C2N=1 |
| CAS DataBase Reference | 31430-18-9(CAS DataBase Reference) |
| EPA Substance Registry System | Nocodazole (31430-18-9) |
Description and Uses
Nocodazole reversibly binds tubulin and alters tubulin-
Nocodazole has been shown to enhance CRISPR genome editing efficiency. To see other small molecule CRISPR enhancers, visit sigma.com/CRISPR-enhancers.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H341-H361d |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T,C,F,Xn |
| Risk Statements | 61-40-36/37/38-34-11-68-63 |
| Safety Statements | 53-45-36/37/39-26-16-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | DD6521000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Muta. 2 Repr. 2 |
| Toxicity | sln-smc 1 ppm/16H MUREAV 141,15,84 |







