A6227312
N,N'-Diacetyl chitobiose , ＞98%(HPLC) , 35061-50-8
Synonym(s):
2-Acetamido-2-deoxy-4-O-(2-acetamido-2-deoxy-β-D -gluco-pyranosyl)-D -glucopyranose;4-O-(2-Acetamido-2-deoxy-β-D -glucopyranosyl)-2-acetamido-2-deoxy-D -glucose;Chitobiose
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB548.80 | In Stock |
|
| 10mg | RMB832.80 | In Stock |
|
| 20MG | RMB1415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-247 °C(lit.) |
| Boiling point: | 927.7±65.0 °C(Predicted) |
| alpha | 18.5 - 39.5 º (c=1% in H2O) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Solid |
| pka | 12.85±0.20(Predicted) |
| color | White to Pale Yellow |
| optical activity | +32.3 → +16.0 |
| Water Solubility | H2O: 49.00-51.00mg/mL, clear, colorless |
| BRN | 61689 |
| Stability: | Hygroscopic |
| InChIKey | CDOJPCSDOXYJJF-CBTAGEKQSA-N |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(C)=O)[C@@H]1O |
| LogP | -1.870 (est) |
| CAS DataBase Reference | 35061-50-8(CAS DataBase Reference) |
Description and Uses
Diacetylchitobiose/Chitobiose, a dimer of β(1,4) linked N-acetyl-D glucosamine, is used as an alternative source of N-acetylglucosamine by some bacteria. It is used in fermentation research to study, differentiate and characterize chitobiose transporter systems and enzymes such as β-N-acetylglucosaminidase(s) and chitobiose phosphorylase(s).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
