A6228512
O-(4-Nitrophenylphosphoryl) choline , ≥98% , 21064-69-7
Synonym(s):
p-Nitrophenylphosphorylcholine;NPPC;Phosphocholine 4-nitrophenyl ester
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB228.80 | In Stock |
|
| 250MG | RMB893.60 | In Stock |
|
| 1G | RMB2877.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-218°C |
| storage temp. | -20°C |
| solubility | H2O: 0.1 g/mL, clear, faintly yellow |
| form | Solid |
| color | Pale Yellow to Yellow |
| Water Solubility | Soluble in water |
| Sensitive | Moisture & Light Sensitive |
| BRN | 1895422 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C11H17N2O6P/c1-13(2,3)8-9-18-20(16,17)19-11-6-4-10(5-7-11)12(14)15/h4-7H,8-9H2,1-3H3 |
| InChIKey | NAIXASFEPQPICN-UHFFFAOYSA-N |
| SMILES | C1(=CC=C([N+]([O-])=O)C=C1)OP([O-])(=O)OCC[N+](C)(C)C |
Description and Uses
4-Nitrophenylphosphorylcholine can be used as a reagent used in Phospholipase C assay.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10-21 |
| Storage Class | 11 - Combustible Solids |





![TMA-DPH [N,N,N-Trimethyl-4-(6-phenyl-1,3,5-hexatrien-1-yl)phenylammonium, p-toluenesulfonate]](https://img.chemicalbook.com/CAS/GIF/115534-33-3.gif)
