A6238812
N-[1-(S)-(+)-Ethoxycarbonyl-3-phenylpropyl]-L-alanyl carboxyanhydride , 98% , 84793-24-8
CAS NO.:84793-24-8
Empirical Formula: C16H19NO5
Molecular Weight: 305.33
MDL number: MFCD06411142
EINECS: 212-344-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB191.20 | In Stock |
|
| 100g | RMB379.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-73 °C(lit.) |
| alpha | 36.5 º (c=1, CHCl3) |
| Boiling point: | 414.8±55.0 °C(Predicted) |
| Density | 1.223±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| pka | -2.40±0.40(Predicted) |
| optical activity | [α]20/D +36.5°, c = 1 in chloroform |
| BRN | 5608080 |
| Major Application | peptide synthesis |
| InChI | 1S/C16H19NO5/c1-3-21-15(19)13(10-9-12-7-5-4-6-8-12)17-11(2)14(18)22-16(17)20/h4-8,11,13H,3,9-10H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | GFZFELCFSBCPDB-AAEUAGOBSA-N |
| SMILES | CCOC(=O)[C@H](CCc1ccccc1)N2[C@@H](C)C(=O)OC2=O |
| CAS DataBase Reference | 84793-24-8(CAS DataBase Reference) |
Description and Uses
N-[1-(S)-Ethoxycarbonyl-3-phenylpropyl]-L-alanine-N-carboxyanhydride is an impurity of Enalapril (E555250), an?antihypertensive and an angiotensin-converting enzyme (ACE) inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H317-H318 |
| Precautionary statements | P261-P272-P280-P302+P352-P305+P351+P338-P333+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43-41 |
| Safety Statements | 22-24/25-36-26-37/39-24 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Sens. 1 |

![N-[1-(S)-(+)-Ethoxycarbonyl-3-phenylpropyl]-L-alanyl carboxyanhydride](https://img.chemicalbook.com/CAS/GIF/84793-24-8.gif)


