A6238912
N-Boc-DL-proline , 98% , 59433-50-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 100g | RMB192.00 | In Stock |
|
| 25g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-135°C |
| Boiling point: | 337.2±35.0 °C(Predicted) |
| Density | 1.201±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.01±0.20(Predicted) |
| Appearance | White to off-white Powder |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C10H17NO4/c1-10(2,3)15-9(14)11-6-4-5-7(11)8(12)13/h7H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | ZQEBQGAAWMOMAI-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCC1C(O)=O |
| CAS DataBase Reference | 59433-50-0(CAS DataBase Reference) |
Description and Uses
(±)-N-(tert-Butoxycarbonyl)proline is a useful reagent for the enantiospecific preparation of functionalized hindered triazolopyridinones.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HazardClass | IRRITANT |
