A6240212
N-Formyl-L-leucine , 90% , 6113-61-7
Synonym(s):
N-Formyl-L -leucine
CAS NO.:6113-61-7
Empirical Formula: C7H13NO3
Molecular Weight: 159.18
MDL number: MFCD00055861
EINECS: 228-080-4
| Pack Size | Price | Stock | Quantity |
| 500MG | RMB79.20 | In Stock |
|
| 1G | RMB116.80 | In Stock |
|
| 5G | RMB356.00 | In Stock |
|
| 25g | RMB1248.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142 °C |
| Boiling point: | 284.67°C (rough estimate) |
| Density | 1.2013 (rough estimate) |
| refractive index | -39.5 ° (C=1, H2O) |
| storage temp. | -20°C |
| solubility | Ethanol (Sparingly), Methanol (Slightly) |
| form | powder |
| pka | 3.51±0.21(Predicted) |
| color | white |
| Water Solubility | 29.45g/L(temperature not stated) |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H13NO3/c1-5(2)3-6(7(10)11)8-4-9/h4-6H,3H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChIKey | HFBHOAHFRNLZGN-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](CC(C)C)NC=O |
| CAS DataBase Reference | 6113-61-7(CAS DataBase Reference) |
Description and Uses
A synthetic substrate of the lipase inhibitor lipstatin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| WGK Germany | 1 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |



![(2S,3S,5S)-5-[(N-Formyl-L-leucyl)oxy]-2-hexyl-3-hydroxyhexadecanoic Acid (Orlistat Impurity)](https://img.chemicalbook.com/CAS/GIF/130676-66-3.gif)

![N-ForMyl-L-leucine [S-(E)]-1-(2-Nonenyl)dodecyl Ester](https://img.chemicalbook.com/CAS/GIF/130676-63-0.gif)

![[2S-[2α(R*),3β]]-N-ForMyl-](https://img.chemicalbook.com/CAS/GIF/104872-28-8.gif)