A6243712
2,3-Dimethyl-4-nitropyridine N-Oxide , 97% , 37699-43-7
CAS NO.:37699-43-7
Empirical Formula: C7H8N2O3
Molecular Weight: 168.15
MDL number: MFCD00065172
EINECS: 609-469-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB58.40 | In Stock |
|
| 100G | RMB208.00 | In Stock |
|
| 500g | RMB1016.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-98 °C (lit.) |
| Boiling point: | 297.07°C (rough estimate) |
| Density | 1.3722 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -1.03±0.10(Predicted) |
| form | Powder or Crystalline Powder |
| color | Pale yellow to yellow |
| BRN | 1569438 |
| InChI | InChI=1S/C7H8N2O3/c1-5-6(2)8(10)4-3-7(5)9(11)12/h3-4H,1-2H3 |
| InChIKey | CFMTVTYBZMKULI-UHFFFAOYSA-N |
| SMILES | C1(C)[N+]([O-])=CC=C([N+]([O-])=O)C=1C |
| CAS DataBase Reference | 37699-43-7(CAS DataBase Reference) |
Description and Uses
Nitropyridine oxide derivative,Nitropyridine oxide derivatives show carcinogenicity and mutagenicity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | UT2807000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![2-[3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridylmethylthio]-1H-benzimidazole](https://img.chemicalbook.com/CAS/GIF/103577-40-8.gif)


