A6244912
Phenaceturic Acid , ≥97% , 500-98-1
CAS NO.:500-98-1
Empirical Formula: C10H11NO3
Molecular Weight: 193.2
MDL number: MFCD00021744
EINECS: 207-916-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB57.60 | In Stock |
|
| 5G | RMB167.20 | In Stock |
|
| 25G | RMB687.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144°C |
| Boiling point: | 476.5±38.0 °C(Predicted) |
| Density | 1.239±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Slightly) |
| pka | 3.48±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C10H11NO3/c12-9(11-7-10(13)14)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)(H,13,14) |
| InChIKey | UTYVDVLMYQPLQB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CNC(CC1=CC=CC=C1)=O |
| CAS DataBase Reference | 500-98-1 |
Description and Uses
A metabolite of carboxylic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |







