A6245112
N-(Methoxycarbonyl) Maleimide , ≥98.0% , 55750-48-6
CAS NO.:55750-48-6
Empirical Formula: C6H5NO4
Molecular Weight: 155.11
MDL number: MFCD00042755
EINECS: 259-792-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB237.60 | In Stock |
|
| 25G | RMB1103.20 | In Stock |
|
| 100g | RMB3879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 63-65 °C |
| Boiling point: | 242.5±23.0 °C(Predicted) |
| Density | 1.496±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Chloroform |
| form | Solid |
| pka | -3.17±0.20(Predicted) |
| color | Off-White to Pink |
| BRN | 1450638 |
| InChI | InChI=1S/C6H5NO4/c1-11-6(10)7-4(8)2-3-5(7)9/h2-3H,1H3 |
| InChIKey | LLAZQXZGAVBLRX-UHFFFAOYSA-N |
| SMILES | N1(C(OC)=O)C(=O)C=CC1=O |
Description and Uses
N-(Methoxycarbonyl) Maleimide (cas# 55750-48-6) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |







