A6246612
nalidixic acid sodium salt , 98% , 3374-05-8
Synonym(s):
1-Ethyl-1,4-dihydro-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylic acid sodium salt
CAS NO.：3374-05-8
Empirical Formula: C12H11N2NaO3
Molecular Weight: 254.22
MDL number: MFCD00064376
EINECS: 222-159-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB74.40 | In Stock |
|
| 5G | RMB275.20 | In Stock |
|
| 25G | RMB987.20 | In Stock |
|
| 100G | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >280℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: 50 mg/mL, clear, faintly yellow |
| form | powder |
| color | White to off-white |
| Water Solubility | Soluble at 50mg/ml in water |
| BRN | 3580062 |
| InChI | InChI=1S/C12H12N2O3.Na.H/c1-3-14-6-9(12(16)17)10(15)8-5-4-7(2)13-11(8)14;;/h4-6H,3H2,1-2H3,(H,16,17);; |
| InChIKey | XVRRVENPZKMSNF-UHFFFAOYSA-N |
| SMILES | C(N1C=C(C(=O)O)C(=O)C2=CC=C(C)N=C12)C.[NaH] |
| CAS DataBase Reference | 3374-05-8(CAS DataBase Reference) |
Description and Uses
anesthetic (local)
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351 |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | 42/43 |
| Safety Statements | 22-36/37-45 |
| WGK Germany | - |
| RTECS | QN2885500 |
| F | 8-10 |
| HS Code | 29339900 |
