A6248312
N-tert-Butoxycarbonyl Tyramine , ≥97.0%(GC) , 64318-28-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1g | RMB40.80 | In Stock |
|
| 5G | RMB156.00 | In Stock |
|
| 25G | RMB554.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-75 °C |
| Boiling point: | 395.7±25.0 °C(Predicted) |
| Density | 1.100±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 10.01±0.15(Predicted) |
| form | Solid |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C13H19NO3/c1-13(2,3)17-12(16)14-9-8-10-4-6-11(15)7-5-10/h4-7,15H,8-9H2,1-3H3,(H,14,16) |
| InChIKey | ILNOTKMMDBWGOK-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NCCC1=CC=C(O)C=C1 |
Description and Uses
Intermediate in the preparation of Thyroxin derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




