A6248612
6-Nitrobenzothiazole , 99% , 2942-06-5
CAS NO.：2942-06-5
Empirical Formula: C7H4N2O2S
Molecular Weight: 180.18
MDL number: MFCD00014569
EINECS: 220-933-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB85.60 | In Stock |
|
| 25G | RMB384.48 | In Stock |
|
| 100G | RMB1227.20 | In Stock |
|
| 250g | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-178 °C (lit.) |
| Boiling point: | 333.7±15.0 °C(Predicted) |
| Density | 1.525±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -1.33±0.10(Predicted) |
| Appearance | Light yellow to light brown Solid |
| BRN | 7824 |
| InChI | InChI=1S/C7H4N2O2S/c10-9(11)5-1-2-6-7(3-5)12-4-8-6/h1-4H |
| InChIKey | QLUFBCVWKTWKBF-UHFFFAOYSA-N |
| SMILES | S1C2=CC([N+]([O-])=O)=CC=C2N=C1 |
| CAS DataBase Reference | 2942-06-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 6-Nitrobenzothiazole(2942-06-5) |
Description and Uses
A related compound of 1,2,3-benzothiadiazoles
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29342000 |
