A6258212
4-Nitrophenethylamine hydrochloride , ≥98%(HPLC) , 29968-78-3
Synonym(s):
2-(4-Nitrophenyl)ethylamine hydrochloride
CAS NO.:29968-78-3
Empirical Formula: C8H11ClN2O2
Molecular Weight: 202.64
MDL number: MFCD00012900
EINECS: 249-980-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB88.00 | In Stock |
|
| 100G | RMB325.60 | In Stock |
|
| 500g | RMB1435.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in methanol almost transparency. |
| form | Crystalline Powder |
| color | Yellow to yellow-green |
| BRN | 3568915 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H10N2O2.ClH/c9-6-5-7-1-3-8(4-2-7)10(11)12;/h1-4H,5-6,9H2;1H |
| InChIKey | JVMHULJEYUQYSH-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)C=CC(CCN)=CC=1.Cl |
| CAS DataBase Reference | 29968-78-3(CAS DataBase Reference) |
Description and Uses
4-Nitrophenethylamine hydrochloride was used in the synthesis of ortho-metalated primary phenethylamines complexes containing six-membered palladacycles and N-(4-nitrophenethyl)formamide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29214990 |
| Storage Class | 11 - Combustible Solids |





