A6260412
N-Acetylsulfanilyl chloride , 98% , 121-60-8
Synonym(s):
4-Acetamidobenzenesulfonyl chloride
CAS NO.:121-60-8
Empirical Formula: C8H8ClNO3S
Molecular Weight: 233.67
MDL number: MFCD00007442
EINECS: 204-485-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 50G | RMB79.20 | In Stock |
|
| 100G | RMB128.00 | In Stock |
|
| 250G | RMB215.20 | In Stock |
|
| 500G | RMB351.20 | In Stock |
|
| 1KG | RMB639.20 | In Stock |
|
| 5KG | RMB2535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 142-145 °C (dec.)(lit.) |
| Boiling point: | 426.8±28.0 °C(Predicted) |
| Density | 1.2977 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.6300 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| pka | 13.75±0.70(Predicted) |
| form | Granular Crystalline Powder or Crystals |
| color | White to cream-beige |
| Water Solubility | SLIGHTLY SOLUBLE |
| Sensitive | Moisture Sensitive |
| Merck | 14,103 |
| BRN | 746676 |
| InChI | 1S/C8H8ClNO3S/c1-6(11)10-7-2-4-8(5-3-7)14(9,12)13/h2-5H,1H3,(H,10,11) |
| InChIKey | GRDXCFKBQWDAJH-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(cc1)S(Cl)(=O)=O |
| LogP | 2.05 at 25℃ |
| CAS DataBase Reference | 121-60-8(CAS DataBase Reference) |
| NIST Chemistry Reference | P-acetamidobenzene sulfonyl chloride(121-60-8) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 4-(acetylamino)- (121-60-8) |
Description and Uses
A sulfanilamide derivative of Chitosan
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 22-34-37 |
| Safety Statements | 26-36/37/39-45-28B |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DB8837500 |
| F | 9-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29242995 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B STOT SE 3 |
| Hazardous Substances Data | 121-60-8(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: > 3200mg/kg |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





