A6260812
Naphthalene-d8 , 99atom%D,≥98% , 1146-65-2
Synonym(s):
1,2,3,4,5,6,7,8-Octadeuterionaphthalene
CAS NO.：1146-65-2
Empirical Formula: C10D8
Molecular Weight: 136.22
MDL number: MFCD00001743
EINECS: 214-552-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB479.20 | In Stock |
|
| 5G | RMB1887.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-82 °C(lit.) |
| Boiling point: | 218 °C(lit.) |
| Density | 1.242 g/cm3 |
| vapor density | 4.4 (vs air) |
| vapor pressure | 0.03 mm Hg ( 25 °C) |
| refractive index | 1.58075 (589.3 nm 98℃) |
| Flash point: | 174 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystals or Crystalline Powder |
| color | White |
| explosive limit | 0.9-5.9%(V) |
| Stability: | Stable. Incompatible with oxidizing agents. Flammable. |
| Major Application | electronics |
| InChI | 1S/C10H8/c1-2-6-10-8-4-3-7-9(10)5-1/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| InChIKey | UFWIBTONFRDIAS-PGRXLJNUSA-N |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c([2H])c([2H])c([2H])c2c1[2H] |
| CAS DataBase Reference | 1146-65-2(CAS DataBase Reference) |
| EPA Substance Registry System | Naphthalene-d8 (1146-65-2) |
| CAS Number Unlabeled | 91-20-3 |
Description and Uses
May be used as an analytical standard
Safety
| Symbol(GHS) |     GHS02,GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H228-H302-H351-H410 |
| Precautionary statements | P202-P210-P240-P273-P301+P312-P308+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,N |
| Risk Statements | 22-40-50/53-67-36/37/38 |
| Safety Statements | 36/37-46-60-61-24/25-23 |
| RIDADR | UN 1334 4.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 28459000 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Flam. Sol. 2 |
