A6262612
<i>N</i>-(2-Hydroxyethyl)phthalimide , 98% , 3891-07-4
Synonym(s):
2-Phthalimidoethanol
CAS NO.:3891-07-4
Empirical Formula: C10H9NO3
Molecular Weight: 191.18
MDL number: MFCD00005903
EINECS: 223-434-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB23.20 | In Stock |
|
| 100G | RMB43.20 | In Stock |
|
| 500G | RMB158.40 | In Stock |
|
| 2.5kg | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-128 °C(lit.) |
| Boiling point: | 326.92°C (rough estimate) |
| Density | 1.2722 (rough estimate) |
| refractive index | 1.5310 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 14.40±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| BRN | 147214 |
| InChI | InChI=1S/C10H9NO3/c12-6-5-11-9(13)7-3-1-2-4-8(7)10(11)14/h1-4,12H,5-6H2 |
| InChIKey | MWFLUYFYHANMCM-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CCO |
| CAS DataBase Reference | 3891-07-4(CAS DataBase Reference) |
| NIST Chemistry Reference | N-2-hydroxyethyl phthalimide(3891-07-4) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-(2-hydroxyethyl)- (3891-07-4) |
Description and Uses
N-(2-Hydroxyethyl)phthalimide is used as a reagent to synthesize (-)-R-rolipram is a phosphodiesterase 4 inhibitor that is used to treat depression. N-(2-Hydroxyethyl)phthalimide is also used as a reagent to synthesize FR252921, a compound that acts as an immunosuppressant. Amlodipine Impurity 6
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-26-36/37/39-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |







