A6262912
N-Ethoxycarbonylphthalimide , 98% , 22509-74-6
Synonym(s):
N-Ethoxycarbonylphthalimide;Ethyl 1,3-dioxo-2-isoindolinecarboxylate;Ethyl phthalimide-N-carboxylate
CAS NO.:22509-74-6
Empirical Formula: C11H9NO4
Molecular Weight: 219.19
MDL number: MFCD00005893
EINECS: 245-048-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB97.60 | In Stock |
|
| 100G | RMB340.00 | In Stock |
|
| 500G | RMB1548.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-92 °C(lit.) |
| Boiling point: | 360°C (rough estimate) |
| Density | 1.3219 (rough estimate) |
| vapor pressure | 0.003-0.006Pa at 20-25℃ |
| refractive index | 1.4950 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -3.02±0.20(Predicted) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | insoluble |
| BRN | 196340 |
| InChI | 1S/C11H9NO4/c1-2-16-11(15)12-9(13)7-5-3-4-6-8(7)10(12)14/h3-6H,2H2,1H3 |
| InChIKey | VRHAQNTWKSVEEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1C(=O)c2ccccc2C1=O |
| LogP | 1.1 at 20℃ and pH6.6-6.9 |
| CAS DataBase Reference | 22509-74-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2H-isoindole-2-carboxylic acid, 1,3-dihydro-1,3-dioxo-, ethyl ester(22509-74-6) |
| EPA Substance Registry System | 2H-Isoindole-2-carboxylic acid, 1,3-dihydro-1,3-dioxo-, ethyl ester (22509-74-6) |
Description and Uses
N-Carbethoxyphthalimide is used in the synthetic preparation of a novel dual binders as potent, selective, and orally bioavailable tankyrase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264b-P270-P301+P312-P330-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36/37/39-26-36 |
| WGK Germany | 3 |
| RTECS | NR3459500 |
| F | 10 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29251995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 |






