A6263012
<i>N</i><sup>1</sup>-Methyl-4-nitro-1,2-phenylenediamine , >98.0% , 41939-61-1
CAS NO.:41939-61-1
Empirical Formula: C7H9N3O2
Molecular Weight: 167.17
MDL number: MFCD00156607
EINECS: 808-144-3
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.80 | In Stock |
|
| 1G | RMB60.48 | In Stock |
|
| 5G | RMB155.20 | In Stock |
|
| 25G | RMB591.20 | In Stock |
|
| 100G | RMB2039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 174-176° |
| Boiling point: | 366.8±32.0 °C(Predicted) |
| Density | 1.358±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.23±0.10(Predicted) |
| color | Red Orange to Brown |
| InChI | InChI=1S/C7H9N3O2/c1-9-7-3-2-5(10(11)12)4-6(7)8/h2-4,9H,8H2,1H3 |
| InChIKey | MNIKERWISBANET-UHFFFAOYSA-N |
| SMILES | C1(NC)=CC=C([N+]([O-])=O)C=C1N |
| CAS DataBase Reference | 41939-61-1 |
Description and Uses
N’-Methyl-4-nitrophenylene-1,2-diamine (cas# 41939-61-1) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| RIDADR | UN 2811 6.1/PG III |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2921511990 |




![EThanediamide,N1,N2-bis([1,1'-biphenyl]-2-yl)-](https://img.chemicalbook.com/CAS/20180601/GIF/21022-17-3.gif)


