A6264312
Nicotinic Acid <i>N</i>-Oxide , >98.0%(T) , 2398-81-4
CAS NO.:2398-81-4
Empirical Formula: C6H5NO3
Molecular Weight: 139.11
MDL number: MFCD00006201
EINECS: 219-265-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB256.80 | In Stock |
|
| 500G | RMB1095.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-255 °C (dec.)(lit.) |
| Boiling point: | 255.04°C (rough estimate) |
| Density | 1.4429 (rough estimate) |
| refractive index | 1.5423 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | benzene: insoluble |
| form | Fine Crystalline Powder |
| pka | 3.19±0.10(Predicted) |
| color | Beige |
| Merck | 14,6941 |
| BRN | 115860 |
| InChI | InChI=1S/C6H5NO3/c8-6(9)5-2-1-3-7(10)4-5/h1-4H,(H,8,9) |
| InChIKey | FJCFFCXMEXZEIM-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=CC=1C(O)=O |
| CAS DataBase Reference | 2398-81-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Pyridinecarboxylic acid, 1-oxide(2398-81-4) |
| EPA Substance Registry System | 3-Pyridinecarboxylic acid, 1-oxide (2398-81-4) |
Description and Uses
Nicotinic acid N-oxide was used in a study to develop liquid chromatographic method for determination of free nicotinic acid and its metabolites in plasma and urine. It was used to synthesize and characterize peroxo complexes of vanadium(V) and molybdenum (VI) with nicotinic acid and nicotinic acid N-oxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29333999 |




