A6268112
<i>N</i>-(2,6-Dimethylphenyl)piperidine-2-carboxamide , >98.0%(HPLC)(T) , 15883-20-2
CAS NO.：15883-20-2
Empirical Formula: C14H20N2O
Molecular Weight: 232.32
MDL number: MFCD01701244
EINECS: 605-165-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB28.00 | In Stock |
|
| 25G | RMB81.60 | In Stock |
|
| 100G | RMB312.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114-1170C |
| Boiling point: | 392.3±42.0 °C(Predicted) |
| Density | 1.087±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.85±0.70(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C14H20N2O/c1-10-6-5-7-11(2)13(10)16-14(17)12-8-3-4-9-15-12/h5-7,12,15H,3-4,8-9H2,1-2H3,(H,16,17) |
| InChIKey | SILRCGDPZGQJOQ-UHFFFAOYSA-N |
| SMILES | N1CCCCC1C(NC1=C(C)C=CC=C1C)=O |
| CAS DataBase Reference | 15883-20-2(CAS DataBase Reference) |
Description and Uses
N-(2,6-Dimethylphenyl)-1-methyl-1,2,5,6-tetrahydropyridine-2-carboxamide is a Bupivacaine (B689561) Impurity. Bupivacaine (B689561) is a sodium channel blocker, local anesthetic.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| RTECS | TM6076000 |
| HazardClass | 6.1 |
| HS Code | 2933399990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
