A6271612
1-(2-Naphthyl)ethanol , 98% , 7228-47-9
CAS NO.：7228-47-9
Empirical Formula: C12H12O
Molecular Weight: 172.22
MDL number: MFCD00004111
EINECS: 230-630-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB100.80 | In Stock |
|
| 25G | RMB354.40 | In Stock |
|
| 100G | RMB1066.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-78 °C (lit.) |
| Boiling point: | 180-184 °C (15 mmHg) |
| Density | 1.113±0.06 g/cm3(Predicted) |
| Flash point: | 170°C/13mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| pka | 14.36±0.20(Predicted) |
| form | Powder |
| color | White to yellow |
| BRN | 1907449 |
| InChI | InChI=1S/C12H12O/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-6,9,13H,7-8H2 |
| InChIKey | VCZANYLMPFRUHG-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=CC=C2)=CC=C1CCO |
| CAS DataBase Reference | 7228-47-9(CAS DataBase Reference) |
| NIST Chemistry Reference | «ALPHA»-methyl-2-naphthalenemethanol(7228-47-9) |
Description and Uses
1-(Naphthalen-2-yl)ethanol is a reagent used in the chemical-enzymic preparation and resolution of β-naphthyl alcohols. A cinacalcet impurity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2906290090 |
