A6277712
<i>N</i>-Succinimidyl Acrylate , >98.0%(GC) , 38862-24-7
Synonym(s):
N-Acryloxysuccinimide
| Pack Size | Price | Stock | Quantity |
| 1G | RMB97.60 | In Stock |
|
| 5G | RMB331.20 | In Stock |
|
| 25G | RMB1256.80 | In Stock |
|
| 100g | RMB4779.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69 °C |
| Boiling point: | 298.4°C (rough estimate) |
| Density | 1.4523 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| solubility | soluble in Toluene |
| form | Crystals and Chunks |
| color | Yellow |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H7NO4/c1-2-7(11)12-8-5(9)3-4-6(8)10/h2H,1,3-4H2 |
| InChIKey | YXMISKNUHHOXFT-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)C=C |
| CAS DataBase Reference | 38862-24-7(CAS DataBase Reference) |
Description and Uses
Acrylic acid N-hydroxysuccinimide ester (NAS) is a general acrylating agent that is used in the synthesis of:
- Acrylated hyaluronic acid (HA) hydrogel for bone regeneration applications.
- Injectable, biodegradable, and thermosensitive copolymers for tissue engineering.
- Imidazole-based biocompatible, aqueous quantum dots (QDs).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40-48/20/22-36-22 |
| Safety Statements | 36-26-37/39 |
| WGK Germany | 2 |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |




![(E)-5-[2-(2-CARBOXYVINYL)]-2'-DEOXYURIDINE N-HYDROXY-SUCCIMIDE ESTER](https://img.chemicalbook.com/CAS/GIF/869355-24-8.gif)


