A6282812
(+)-<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetramethyl-<small>L</small>-tartardiamide , >98.0% , 26549-65-5
Synonym(s):
(+)-L -Tartaric acid bis(dimethylamide);(R,R)-(+)-2,3-Dihydroxy-N,N,N′,N′-tetramethylsuccinamide
| Pack Size | Price | Stock | Quantity |
| 5G | RMB229.60 | In Stock |
|
| 25G | RMB964.00 | In Stock |
|
| 100g | RMB3139.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184-186 °C(lit.) |
| Boiling point: | 342.71°C (rough estimate) |
| alpha | 46 º (c=3, EtOH) |
| Density | 1.2441 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Ethanol (Slightly, Heated), Water (Slightly) |
| form | Solid |
| pka | 11.79±0.20(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D +46°, c = 3 in ethanol |
| BRN | 1959244 |
| InChI | InChI=1S/C8H16N2O4/c1-9(2)7(13)5(11)6(12)8(14)10(3)4/h5-6,11-12H,1-4H3/t5-,6-/m1/s1 |
| InChIKey | PCYDYHRBODKVEL-PHDIDXHHSA-N |
| SMILES | C(N(C)C)(=O)[C@H](O)[C@@H](O)C(N(C)C)=O |
| CAS DataBase Reference | 26549-65-5(CAS DataBase Reference) |
Description and Uses
(2R,3R)-N,N,N’,N’-Tetramethyltartramide (cas# 26549-65-5) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |



